C16H18FN3S — CID 63290975
5-fluoro-2-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]benzenecarboximidamide (PubChem CID 63290975) has the molecular formula C16H18FN3S and a molecular weight of 303.41 g/mol. Its IUPAC name is 5-fluoro-2-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]benzenecarboximidamide.
| Compound Name | 5-fluoro-2-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 63290975 |
| Molecular Formula | C16H18FN3S |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 5-fluoro-2-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)ccc1CN1CCc2sccc2C1C |
| InChI | InChI=1S/C16H18FN3S/c1-10-13-5-7-21-15(13)4-6-20(10)9-11-2-3-12(17)8-14(11)16(18)19/h2-3,5,7-8,10H,4,6,9H2,1H3,(H3,18,19) |
| InChIKey | FFUOWZDSFMGHFQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|