C15H17ClN2S — CID 79583191
4-chloro-2-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]aniline (PubChem CID 79583191) has the molecular formula C15H17ClN2S and a molecular weight of 292.84 g/mol. Its IUPAC name is 4-chloro-2-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]aniline.
| Compound Name | 4-chloro-2-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 79583191 |
| Molecular Formula | C15H17ClN2S |
| Molecular Weight | 292.84 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 4-chloro-2-[(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methyl]aniline |
| SMILES | CC1c2ccsc2CCN1Cc1cc(Cl)ccc1N |
| InChI | InChI=1S/C15H17ClN2S/c1-10-13-5-7-19-15(13)4-6-18(10)9-11-8-12(16)2-3-14(11)17/h2-3,5,7-8,10H,4,6,9,17H2,1H3 |
| InChIKey | UHNXNPUGAUWVOU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.84 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|