C17H22N2S — CID 107274405
2-[3-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]aniline (PubChem CID 107274405) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is 2-[3-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]aniline.
| Compound Name | 2-[3-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]aniline |
|---|---|
| PubChem CID | 107274405 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2-[3-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propyl]aniline |
| SMILES | CC1c2ccsc2CCN1CCCc1ccccc1N |
| InChI | InChI=1S/C17H22N2S/c1-13-15-9-12-20-17(15)8-11-19(13)10-4-6-14-5-2-3-7-16(14)18/h2-3,5,7,9,12-13H,4,6,8,10-11,18H2,1H3 |
| InChIKey | XSGDYSWKHKAPQR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|