C16H19NO3S2 — CID 32973870
phenyl 2-[(4R)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethanesulfonate (PubChem CID 32973870) has the molecular formula C16H19NO3S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is phenyl 2-[(4R)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethanesulfonate.
| Compound Name | phenyl 2-[(4R)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethanesulfonate |
|---|---|
| PubChem CID | 32973870 |
| Molecular Formula | C16H19NO3S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | phenyl 2-[(4R)-4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethanesulfonate |
| SMILES | C[C@@H]1c2ccsc2CCN1CCS(=O)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C16H19NO3S2/c1-13-15-8-11-21-16(15)7-9-17(13)10-12-22(18,19)20-14-5-3-2-4-6-14/h2-6,8,11,13H,7,9-10,12H2,1H3/t13-/m1/s1 |
| InChIKey | USJOKKJLVNGKSX-CYBMUJFWSA-N |
| XLogP | 3.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|