C17H17NOS — CID 114486091
4-[(2,5-dimethylphenyl)sulfinylmethyl]-3-methylbenzonitrile (PubChem CID 114486091) has the molecular formula C17H17NOS and a molecular weight of 283.40 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)sulfinylmethyl]-3-methylbenzonitrile.
| Compound Name | 4-[(2,5-dimethylphenyl)sulfinylmethyl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 114486091 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)sulfinylmethyl]-3-methylbenzonitrile |
| SMILES | Cc1ccc(C)c(S(=O)Cc2ccc(C#N)cc2C)c1 |
| InChI | InChI=1S/C17H17NOS/c1-12-4-5-13(2)17(8-12)20(19)11-16-7-6-15(10-18)9-14(16)3/h4-9H,11H2,1-3H3 |
| InChIKey | OBNNKXCSBKJYHT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |