C16H15NOS — CID 64691074
4-[(2,5-dimethylphenyl)sulfinylmethyl]benzonitrile (PubChem CID 64691074) has the molecular formula C16H15NOS and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-[(2,5-dimethylphenyl)sulfinylmethyl]benzonitrile.
| Compound Name | 4-[(2,5-dimethylphenyl)sulfinylmethyl]benzonitrile |
|---|---|
| PubChem CID | 64691074 |
| Molecular Formula | C16H15NOS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-[(2,5-dimethylphenyl)sulfinylmethyl]benzonitrile |
| SMILES | Cc1ccc(C)c(S(=O)Cc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C16H15NOS/c1-12-3-4-13(2)16(9-12)19(18)11-15-7-5-14(10-17)6-8-15/h3-9H,11H2,1-2H3 |
| InChIKey | WDSFCINOOBSESU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |