C12H16N2O2S — CID 114486330
4-(1-aminopropan-2-ylsulfonylmethyl)-3-methylbenzonitrile (PubChem CID 114486330) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 4-(1-aminopropan-2-ylsulfonylmethyl)-3-methylbenzonitrile.
| Compound Name | 4-(1-aminopropan-2-ylsulfonylmethyl)-3-methylbenzonitrile |
|---|---|
| PubChem CID | 114486330 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 4-(1-aminopropan-2-ylsulfonylmethyl)-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1CS(=O)(=O)C(C)CN |
| InChI | InChI=1S/C12H16N2O2S/c1-9-5-11(7-14)3-4-12(9)8-17(15,16)10(2)6-13/h3-5,10H,6,8,13H2,1-2H3 |
| InChIKey | UOUMCYOMFSOVPN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |