C11H15N3 — CID 130062223
3-(1,2-diaminoethyl)-4-ethylbenzonitrile (PubChem CID 130062223) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-(1,2-diaminoethyl)-4-ethylbenzonitrile.
| Compound Name | 3-(1,2-diaminoethyl)-4-ethylbenzonitrile |
|---|---|
| PubChem CID | 130062223 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 3-(1,2-diaminoethyl)-4-ethylbenzonitrile |
| SMILES | CCc1ccc(C#N)cc1C(N)CN |
| InChI | InChI=1S/C11H15N3/c1-2-9-4-3-8(6-12)5-10(9)11(14)7-13/h3-5,11H,2,7,13-14H2,1H3 |
| InChIKey | UWIBBMHBVSWXBB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |