C16H23ClFN3 — CID 114487914
2-(3-chloro-2-fluorophenyl)-2-(3-pyrrolidin-1-ylpyrrolidin-1-yl)ethanamine (PubChem CID 114487914) has the molecular formula C16H23ClFN3 and a molecular weight of 311.83 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-2-(3-pyrrolidin-1-ylpyrrolidin-1-yl)ethanamine.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-2-(3-pyrrolidin-1-ylpyrrolidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 114487914 |
| Molecular Formula | C16H23ClFN3 |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-2-(3-pyrrolidin-1-ylpyrrolidin-1-yl)ethanamine |
| SMILES | NCC(c1cccc(Cl)c1F)N1CCC(N2CCCC2)C1 |
| InChI | InChI=1S/C16H23ClFN3/c17-14-5-3-4-13(16(14)18)15(10-19)21-9-6-12(11-21)20-7-1-2-8-20/h3-5,12,15H,1-2,6-11,19H2 |
| InChIKey | XRSDDYAZOFJIEG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |