C16H23Cl2N3 — CID 63149837
2-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-2-(2,3-dichlorophenyl)ethanamine (PubChem CID 63149837) has the molecular formula C16H23Cl2N3 and a molecular weight of 328.29 g/mol. Its IUPAC name is 2-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-2-(2,3-dichlorophenyl)ethanamine.
| Compound Name | 2-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-2-(2,3-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 63149837 |
| Molecular Formula | C16H23Cl2N3 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-2-(2,3-dichlorophenyl)ethanamine |
| SMILES | NCC(c1cccc(Cl)c1Cl)N1CCCN2CCCC2C1 |
| InChI | InChI=1S/C16H23Cl2N3/c17-14-6-1-5-13(16(14)18)15(10-19)21-9-3-8-20-7-2-4-12(20)11-21/h1,5-6,12,15H,2-4,7-11,19H2 |
| InChIKey | CMKNSJIRNXSSCS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |