C11H13ClFNS — CID 114488651
2-(3-chloro-2-fluorophenyl)-5-methyl-1,3-thiazinane (PubChem CID 114488651) has the molecular formula C11H13ClFNS and a molecular weight of 245.75 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-5-methyl-1,3-thiazinane.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-5-methyl-1,3-thiazinane |
|---|---|
| PubChem CID | 114488651 |
| Molecular Formula | C11H13ClFNS |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-5-methyl-1,3-thiazinane |
| SMILES | CC1CNC(c2cccc(Cl)c2F)SC1 |
| InChI | InChI=1S/C11H13ClFNS/c1-7-5-14-11(15-6-7)8-3-2-4-9(12)10(8)13/h2-4,7,11,14H,5-6H2,1H3 |
| InChIKey | NZSJHYAARMKJLZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |