C15H19ClFNO3 — CID 114489078
3-[1-[(3-chloro-2-fluorophenyl)methyl]piperidin-4-yl]oxypropanoic acid (PubChem CID 114489078) has the molecular formula C15H19ClFNO3 and a molecular weight of 315.77 g/mol. Its IUPAC name is 3-[1-[(3-chloro-2-fluorophenyl)methyl]piperidin-4-yl]oxypropanoic acid.
| Compound Name | 3-[1-[(3-chloro-2-fluorophenyl)methyl]piperidin-4-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 114489078 |
| Molecular Formula | C15H19ClFNO3 |
| Molecular Weight | 315.77 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 3-[1-[(3-chloro-2-fluorophenyl)methyl]piperidin-4-yl]oxypropanoic acid |
| SMILES | O=C(O)CCOC1CCN(Cc2cccc(Cl)c2F)CC1 |
| InChI | InChI=1S/C15H19ClFNO3/c16-13-3-1-2-11(15(13)17)10-18-7-4-12(5-8-18)21-9-6-14(19)20/h1-3,12H,4-10H2,(H,19,20) |
| InChIKey | QHASYNNMQKANHA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.77 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |