C15H20INO3 — CID 65479275
3-[1-[(4-iodophenyl)methyl]piperidin-4-yl]oxypropanoic acid (PubChem CID 65479275) has the molecular formula C15H20INO3 and a molecular weight of 389.23 g/mol. Its IUPAC name is 3-[1-[(4-iodophenyl)methyl]piperidin-4-yl]oxypropanoic acid.
| Compound Name | 3-[1-[(4-iodophenyl)methyl]piperidin-4-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 65479275 |
| Molecular Formula | C15H20INO3 |
| Molecular Weight | 389.23 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 3-[1-[(4-iodophenyl)methyl]piperidin-4-yl]oxypropanoic acid |
| SMILES | O=C(O)CCOC1CCN(Cc2ccc(I)cc2)CC1 |
| InChI | InChI=1S/C15H20INO3/c16-13-3-1-12(2-4-13)11-17-8-5-14(6-9-17)20-10-7-15(18)19/h1-4,14H,5-11H2,(H,18,19) |
| InChIKey | QLZAHKNNYUVMCB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|