C11H17F3N2O3S — CID 114489834
2-amino-4-methylsulfonyl-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]butan-1-one (PubChem CID 114489834) has the molecular formula C11H17F3N2O3S and a molecular weight of 314.33 g/mol. Its IUPAC name is 2-amino-4-methylsulfonyl-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]butan-1-one.
| Compound Name | 2-amino-4-methylsulfonyl-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 114489834 |
| Molecular Formula | C11H17F3N2O3S |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-amino-4-methylsulfonyl-1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]butan-1-one |
| SMILES | CS(=O)(=O)CCC(N)C(=O)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H17F3N2O3S/c1-20(18,19)7-4-9(15)10(17)16-5-2-8(3-6-16)11(12,13)14/h2,9H,3-7,15H2,1H3 |
| InChIKey | XXDNOQVARABDJP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|