C11H15F3N2O2 — CID 114489846
morpholin-3-yl-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 114489846) has the molecular formula C11H15F3N2O2 and a molecular weight of 264.25 g/mol. Its IUPAC name is morpholin-3-yl-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | morpholin-3-yl-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 114489846 |
| Molecular Formula | C11H15F3N2O2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | morpholin-3-yl-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | O=C(C1COCCN1)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H15F3N2O2/c12-11(13,14)8-1-4-16(5-2-8)10(17)9-7-18-6-3-15-9/h1,9,15H,2-7H2 |
| InChIKey | MAYBDZIVHLJSRZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|