C10H16N2O2 — CID 114408946
3,6-dihydro-2H-pyridin-1-yl(morpholin-3-yl)methanone (PubChem CID 114408946) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 3,6-dihydro-2H-pyridin-1-yl(morpholin-3-yl)methanone.
| Compound Name | 3,6-dihydro-2H-pyridin-1-yl(morpholin-3-yl)methanone |
|---|---|
| PubChem CID | 114408946 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 3,6-dihydro-2H-pyridin-1-yl(morpholin-3-yl)methanone |
| SMILES | O=C(C1COCCN1)N1CC=CCC1 |
| InChI | InChI=1S/C10H16N2O2/c13-10(9-8-14-7-4-11-9)12-5-2-1-3-6-12/h1-2,9,11H,3-8H2 |
| InChIKey | GDNVAXOTLOLGDF-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|