C11H17F3N2 — CID 114489982
1-(pyrrolidin-2-ylmethyl)-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine (PubChem CID 114489982) has the molecular formula C11H17F3N2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 1-(pyrrolidin-2-ylmethyl)-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(pyrrolidin-2-ylmethyl)-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 114489982 |
| Molecular Formula | C11H17F3N2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 1-(pyrrolidin-2-ylmethyl)-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine |
| SMILES | FC(F)(F)C1=CCN(CC2CCCN2)CC1 |
| InChI | InChI=1S/C11H17F3N2/c12-11(13,14)9-3-6-16(7-4-9)8-10-2-1-5-15-10/h3,10,15H,1-2,4-8H2 |
| InChIKey | QERDXHGUUQFVLP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|