C13H21F3N2 — CID 114490113
[1-[2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]cyclobutyl]methanamine (PubChem CID 114490113) has the molecular formula C13H21F3N2 and a molecular weight of 262.32 g/mol. Its IUPAC name is [1-[2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]cyclobutyl]methanamine.
| Compound Name | [1-[2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]cyclobutyl]methanamine |
|---|---|
| PubChem CID | 114490113 |
| Molecular Formula | C13H21F3N2 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | [1-[2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]ethyl]cyclobutyl]methanamine |
| SMILES | NCC1(CCN2CC=C(C(F)(F)F)CC2)CCC1 |
| InChI | InChI=1S/C13H21F3N2/c14-13(15,16)11-2-7-18(8-3-11)9-6-12(10-17)4-1-5-12/h2H,1,3-10,17H2 |
| InChIKey | RCMPRUBFQAOLCE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|