C12H19F3N2O — CID 114490158
N-methyl-4-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]oxolan-3-amine (PubChem CID 114490158) has the molecular formula C12H19F3N2O and a molecular weight of 264.29 g/mol. Its IUPAC name is N-methyl-4-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]oxolan-3-amine.
| Compound Name | N-methyl-4-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]oxolan-3-amine |
|---|---|
| PubChem CID | 114490158 |
| Molecular Formula | C12H19F3N2O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | N-methyl-4-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]oxolan-3-amine |
| SMILES | CNC1COCC1CN1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H19F3N2O/c1-16-11-8-18-7-9(11)6-17-4-2-10(3-5-17)12(13,14)15/h2,9,11,16H,3-8H2,1H3 |
| InChIKey | ZWEYKFDNLROKNJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|