C13H21F3N2O — CID 114490231
N-ethyl-4-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]oxolan-3-amine (PubChem CID 114490231) has the molecular formula C13H21F3N2O and a molecular weight of 278.32 g/mol. Its IUPAC name is N-ethyl-4-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]oxolan-3-amine.
| Compound Name | N-ethyl-4-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]oxolan-3-amine |
|---|---|
| PubChem CID | 114490231 |
| Molecular Formula | C13H21F3N2O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-ethyl-4-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]oxolan-3-amine |
| SMILES | CCNC1COCC1CN1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H21F3N2O/c1-2-17-12-9-19-8-10(12)7-18-5-3-11(4-6-18)13(14,15)16/h3,10,12,17H,2,4-9H2,1H3 |
| InChIKey | UJTOOSLFQHSGCP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|