C13H19F3N2O3 — CID 114490393
2-[ethyl-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]-2-methylpropanoic acid (PubChem CID 114490393) has the molecular formula C13H19F3N2O3 and a molecular weight of 308.30 g/mol. Its IUPAC name is 2-[ethyl-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[ethyl-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 114490393 |
| Molecular Formula | C13H19F3N2O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-[ethyl-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]-2-methylpropanoic acid |
| SMILES | CCN(C(=O)N1CC=C(C(F)(F)F)CC1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C13H19F3N2O3/c1-4-18(12(2,3)10(19)20)11(21)17-7-5-9(6-8-17)13(14,15)16/h5H,4,6-8H2,1-3H3,(H,19,20) |
| InChIKey | WWXDJBUTQGOIOR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|