C9H10F3NO3 — CID 114490496
methyl 2-oxo-2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]acetate (PubChem CID 114490496) has the molecular formula C9H10F3NO3 and a molecular weight of 237.18 g/mol. Its IUPAC name is methyl 2-oxo-2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]acetate.
| Compound Name | methyl 2-oxo-2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]acetate |
|---|---|
| PubChem CID | 114490496 |
| Molecular Formula | C9H10F3NO3 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | methyl 2-oxo-2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]acetate |
| SMILES | COC(=O)C(=O)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H10F3NO3/c1-16-8(15)7(14)13-4-2-6(3-5-13)9(10,11)12/h2H,3-5H2,1H3 |
| InChIKey | IGLZNYJEKPFALO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|