C17H26F3NO3 — CID 169111012
2,2,2-trifluoroethyl 2-[butyl-[(Z,2E)-2-ethylidene-3-methylhex-3-enyl]amino]-2-oxoacetate (PubChem CID 169111012) has the molecular formula C17H26F3NO3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[butyl-[(Z,2E)-2-ethylidene-3-methylhex-3-enyl]amino]-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[butyl-[(Z,2E)-2-ethylidene-3-methylhex-3-enyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 169111012 |
| Molecular Formula | C17H26F3NO3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[butyl-[(Z,2E)-2-ethylidene-3-methylhex-3-enyl]amino]-2-oxoacetate |
| SMILES | C/C=C(CN(CCCC)C(=O)C(=O)OCC(F)(F)F)\C(C)=C/CC |
| InChI | InChI=1S/C17H26F3NO3/c1-5-8-10-21(11-14(7-3)13(4)9-6-2)15(22)16(23)24-12-17(18,19)20/h7,9H,5-6,8,10-12H2,1-4H3/b13-9-,14-7- |
| InChIKey | VHJWQXUBZGZTAB-RJXAORMISA-N |
| XLogP | 4.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|