C15H24ClNO2 — CID 114491618
1-[4-chloro-2-(ethylaminomethyl)phenoxy]-2,3-dimethylbutan-2-ol (PubChem CID 114491618) has the molecular formula C15H24ClNO2 and a molecular weight of 285.82 g/mol. Its IUPAC name is 1-[4-chloro-2-(ethylaminomethyl)phenoxy]-2,3-dimethylbutan-2-ol.
| Compound Name | 1-[4-chloro-2-(ethylaminomethyl)phenoxy]-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 114491618 |
| Molecular Formula | C15H24ClNO2 |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-[4-chloro-2-(ethylaminomethyl)phenoxy]-2,3-dimethylbutan-2-ol |
| SMILES | CCNCc1cc(Cl)ccc1OCC(C)(O)C(C)C |
| InChI | InChI=1S/C15H24ClNO2/c1-5-17-9-12-8-13(16)6-7-14(12)19-10-15(4,18)11(2)3/h6-8,11,17-18H,5,9-10H2,1-4H3 |
| InChIKey | ZKBGOOSFDXLLTR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |