C15H25ClN2O — CID 39291785
2-[4-chloro-2-(ethylaminomethyl)phenoxy]-N,N-diethylethanamine (PubChem CID 39291785) has the molecular formula C15H25ClN2O and a molecular weight of 284.83 g/mol. Its IUPAC name is 2-[4-chloro-2-(ethylaminomethyl)phenoxy]-N,N-diethylethanamine.
| Compound Name | 2-[4-chloro-2-(ethylaminomethyl)phenoxy]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 39291785 |
| Molecular Formula | C15H25ClN2O |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 2-[4-chloro-2-(ethylaminomethyl)phenoxy]-N,N-diethylethanamine |
| SMILES | CCNCc1cc(Cl)ccc1OCCN(CC)CC |
| InChI | InChI=1S/C15H25ClN2O/c1-4-17-12-13-11-14(16)7-8-15(13)19-10-9-18(5-2)6-3/h7-8,11,17H,4-6,9-10,12H2,1-3H3 |
| InChIKey | BQFLURLNSWRAAQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |