C15H25NO3 — CID 114491840
1-[2-(ethylaminomethyl)-5-methoxyphenoxy]-2-methylbutan-2-ol (PubChem CID 114491840) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 1-[2-(ethylaminomethyl)-5-methoxyphenoxy]-2-methylbutan-2-ol.
| Compound Name | 1-[2-(ethylaminomethyl)-5-methoxyphenoxy]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 114491840 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 1-[2-(ethylaminomethyl)-5-methoxyphenoxy]-2-methylbutan-2-ol |
| SMILES | CCNCc1ccc(OC)cc1OCC(C)(O)CC |
| InChI | InChI=1S/C15H25NO3/c1-5-15(3,17)11-19-14-9-13(18-4)8-7-12(14)10-16-6-2/h7-9,16-17H,5-6,10-11H2,1-4H3 |
| InChIKey | AMDYCGPRLYBQDZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |