C13H18ClNO2 — CID 61269264
N-[[2-(3-chloroprop-2-enoxy)-4-methoxyphenyl]methyl]ethanamine (PubChem CID 61269264) has the molecular formula C13H18ClNO2 and a molecular weight of 255.75 g/mol. Its IUPAC name is N-[[2-(3-chloroprop-2-enoxy)-4-methoxyphenyl]methyl]ethanamine.
| Compound Name | N-[[2-(3-chloroprop-2-enoxy)-4-methoxyphenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 61269264 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N-[[2-(3-chloroprop-2-enoxy)-4-methoxyphenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc(OC)cc1OCC=CCl |
| InChI | InChI=1S/C13H18ClNO2/c1-3-15-10-11-5-6-12(16-2)9-13(11)17-8-4-7-14/h4-7,9,15H,3,8,10H2,1-2H3 |
| InChIKey | CYFZKKFAEAMGTN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |