C16H26FNO2 — CID 114492395
1-[2-fluoro-4-[1-(propylamino)ethyl]phenoxy]-2-methylbutan-2-ol (PubChem CID 114492395) has the molecular formula C16H26FNO2 and a molecular weight of 283.39 g/mol. Its IUPAC name is 1-[2-fluoro-4-[1-(propylamino)ethyl]phenoxy]-2-methylbutan-2-ol.
| Compound Name | 1-[2-fluoro-4-[1-(propylamino)ethyl]phenoxy]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 114492395 |
| Molecular Formula | C16H26FNO2 |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1-[2-fluoro-4-[1-(propylamino)ethyl]phenoxy]-2-methylbutan-2-ol |
| SMILES | CCCNC(C)c1ccc(OCC(C)(O)CC)c(F)c1 |
| InChI | InChI=1S/C16H26FNO2/c1-5-9-18-12(3)13-7-8-15(14(17)10-13)20-11-16(4,19)6-2/h7-8,10,12,18-19H,5-6,9,11H2,1-4H3 |
| InChIKey | ZRGSWGUVVISZFA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |