C17H28FNO2 — CID 114492396
3-[[2-fluoro-4-[1-(propylamino)ethyl]phenoxy]methyl]pentan-3-ol (PubChem CID 114492396) has the molecular formula C17H28FNO2 and a molecular weight of 297.41 g/mol. Its IUPAC name is 3-[[2-fluoro-4-[1-(propylamino)ethyl]phenoxy]methyl]pentan-3-ol.
| Compound Name | 3-[[2-fluoro-4-[1-(propylamino)ethyl]phenoxy]methyl]pentan-3-ol |
|---|---|
| PubChem CID | 114492396 |
| Molecular Formula | C17H28FNO2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 3-[[2-fluoro-4-[1-(propylamino)ethyl]phenoxy]methyl]pentan-3-ol |
| SMILES | CCCNC(C)c1ccc(OCC(O)(CC)CC)c(F)c1 |
| InChI | InChI=1S/C17H28FNO2/c1-5-10-19-13(4)14-8-9-16(15(18)11-14)21-12-17(20,6-2)7-3/h8-9,11,13,19-20H,5-7,10,12H2,1-4H3 |
| InChIKey | ZWICGDLEXNXLMH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |