C13H20FNS — CID 43286080
N-[1-(4-ethylsulfanyl-3-fluorophenyl)ethyl]propan-1-amine (PubChem CID 43286080) has the molecular formula C13H20FNS and a molecular weight of 241.37 g/mol. Its IUPAC name is N-[1-(4-ethylsulfanyl-3-fluorophenyl)ethyl]propan-1-amine.
| Compound Name | N-[1-(4-ethylsulfanyl-3-fluorophenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 43286080 |
| Molecular Formula | C13H20FNS |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | N-[1-(4-ethylsulfanyl-3-fluorophenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1ccc(SCC)c(F)c1 |
| InChI | InChI=1S/C13H20FNS/c1-4-8-15-10(3)11-6-7-13(16-5-2)12(14)9-11/h6-7,9-10,15H,4-5,8H2,1-3H3 |
| InChIKey | NDYPPZWNEGXJTH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |