C19H22O3 — CID 11449392
(3R)-5-hydroxy-3-(3-methyl-4-phenylmethoxyphenyl)pentanal (PubChem CID 11449392) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (3R)-5-hydroxy-3-(3-methyl-4-phenylmethoxyphenyl)pentanal.
| Compound Name | (3R)-5-hydroxy-3-(3-methyl-4-phenylmethoxyphenyl)pentanal |
|---|---|
| PubChem CID | 11449392 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (3R)-5-hydroxy-3-(3-methyl-4-phenylmethoxyphenyl)pentanal |
| SMILES | Cc1cc([C@@H](CC=O)CCO)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C19H22O3/c1-15-13-18(17(9-11-20)10-12-21)7-8-19(15)22-14-16-5-3-2-4-6-16/h2-8,11,13,17,21H,9-10,12,14H2,1H3/t17-/m0/s1 |
| InChIKey | QNMHEWMYMNQPLQ-KRWDZBQOSA-N |
| XLogP | 3.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|