C20H22O3 — CID 117495361
3-cyclopropyl-3-(3-methyl-4-phenylmethoxyphenyl)propanoic acid (PubChem CID 117495361) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is 3-cyclopropyl-3-(3-methyl-4-phenylmethoxyphenyl)propanoic acid.
| Compound Name | 3-cyclopropyl-3-(3-methyl-4-phenylmethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 117495361 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 3-cyclopropyl-3-(3-methyl-4-phenylmethoxyphenyl)propanoic acid |
| SMILES | Cc1cc(C(CC(=O)O)C2CC2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C20H22O3/c1-14-11-17(18(12-20(21)22)16-7-8-16)9-10-19(14)23-13-15-5-3-2-4-6-15/h2-6,9-11,16,18H,7-8,12-13H2,1H3,(H,21,22) |
| InChIKey | TUZMWGXXMFRCSW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |