C16H24O4 — CID 114493979
2-(2-ethyl-2-hydroxybutoxy)-4-propoxybenzaldehyde (PubChem CID 114493979) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 2-(2-ethyl-2-hydroxybutoxy)-4-propoxybenzaldehyde.
| Compound Name | 2-(2-ethyl-2-hydroxybutoxy)-4-propoxybenzaldehyde |
|---|---|
| PubChem CID | 114493979 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2-(2-ethyl-2-hydroxybutoxy)-4-propoxybenzaldehyde |
| SMILES | CCCOc1ccc(C=O)c(OCC(O)(CC)CC)c1 |
| InChI | InChI=1S/C16H24O4/c1-4-9-19-14-8-7-13(11-17)15(10-14)20-12-16(18,5-2)6-3/h7-8,10-11,18H,4-6,9,12H2,1-3H3 |
| InChIKey | XCAQNEYEULDCPB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|