C16H22N2O5 — CID 9017740
2-[[2-(2-formyl-5-propoxyphenoxy)acetyl]amino]-N,N-dimethylacetamide (PubChem CID 9017740) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is 2-[[2-(2-formyl-5-propoxyphenoxy)acetyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[2-(2-formyl-5-propoxyphenoxy)acetyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 9017740 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 2-[[2-(2-formyl-5-propoxyphenoxy)acetyl]amino]-N,N-dimethylacetamide |
| SMILES | CCCOc1ccc(C=O)c(OCC(=O)NCC(=O)N(C)C)c1 |
| InChI | InChI=1S/C16H22N2O5/c1-4-7-22-13-6-5-12(10-19)14(8-13)23-11-15(20)17-9-16(21)18(2)3/h5-6,8,10H,4,7,9,11H2,1-3H3,(H,17,20) |
| InChIKey | KEWGOEOMLXERJL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|