C12H26N2O — CID 114496462
1-(3,5-dimethylpiperazin-1-yl)-2,3-dimethylbutan-2-ol (PubChem CID 114496462) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-(3,5-dimethylpiperazin-1-yl)-2,3-dimethylbutan-2-ol.
| Compound Name | 1-(3,5-dimethylpiperazin-1-yl)-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 114496462 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 1-(3,5-dimethylpiperazin-1-yl)-2,3-dimethylbutan-2-ol |
| SMILES | CC1CN(CC(C)(O)C(C)C)CC(C)N1 |
| InChI | InChI=1S/C12H26N2O/c1-9(2)12(5,15)8-14-6-10(3)13-11(4)7-14/h9-11,13,15H,6-8H2,1-5H3 |
| InChIKey | AWNCGDHTQSBXHP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |