C12H26N2O — CID 114447436
1-(4-ethylpiperazin-1-yl)-2,3-dimethylbutan-2-ol (PubChem CID 114447436) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-(4-ethylpiperazin-1-yl)-2,3-dimethylbutan-2-ol.
| Compound Name | 1-(4-ethylpiperazin-1-yl)-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 114447436 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 1-(4-ethylpiperazin-1-yl)-2,3-dimethylbutan-2-ol |
| SMILES | CCN1CCN(CC(C)(O)C(C)C)CC1 |
| InChI | InChI=1S/C12H26N2O/c1-5-13-6-8-14(9-7-13)10-12(4,15)11(2)3/h11,15H,5-10H2,1-4H3 |
| InChIKey | LNAJAKLNFQQSQZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |