C14H29NO — CID 114449017
1-(4,4-dimethylazepan-1-yl)-2,3-dimethylbutan-2-ol (PubChem CID 114449017) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 1-(4,4-dimethylazepan-1-yl)-2,3-dimethylbutan-2-ol.
| Compound Name | 1-(4,4-dimethylazepan-1-yl)-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 114449017 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 1-(4,4-dimethylazepan-1-yl)-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)C(C)(O)CN1CCCC(C)(C)CC1 |
| InChI | InChI=1S/C14H29NO/c1-12(2)14(5,16)11-15-9-6-7-13(3,4)8-10-15/h12,16H,6-11H2,1-5H3 |
| InChIKey | BBLRXUMUXIPJSO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |