C11H20F3NO — CID 65282401
3-(4,4-dimethylazepan-1-yl)-1,1,1-trifluoropropan-2-ol (PubChem CID 65282401) has the molecular formula C11H20F3NO and a molecular weight of 239.28 g/mol. Its IUPAC name is 3-(4,4-dimethylazepan-1-yl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-(4,4-dimethylazepan-1-yl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 65282401 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 3-(4,4-dimethylazepan-1-yl)-1,1,1-trifluoropropan-2-ol |
| SMILES | CC1(C)CCCN(CC(O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H20F3NO/c1-10(2)4-3-6-15(7-5-10)8-9(16)11(12,13)14/h9,16H,3-8H2,1-2H3 |
| InChIKey | MXEBDTBNKAEDQI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |