C12H25NO2 — CID 66222358
1-(2,2-dimethoxyethyl)-4,4-dimethylazepane (PubChem CID 66222358) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-4,4-dimethylazepane.
| Compound Name | 1-(2,2-dimethoxyethyl)-4,4-dimethylazepane |
|---|---|
| PubChem CID | 66222358 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-4,4-dimethylazepane |
| SMILES | COC(CN1CCCC(C)(C)CC1)OC |
| InChI | InChI=1S/C12H25NO2/c1-12(2)6-5-8-13(9-7-12)10-11(14-3)15-4/h11H,5-10H2,1-4H3 |
| InChIKey | BAUYKCHAARNQPK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|