C12H25N3 — CID 65281491
3-(4,4-dimethylazepan-1-yl)-2-methylpropanimidamide (PubChem CID 65281491) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is 3-(4,4-dimethylazepan-1-yl)-2-methylpropanimidamide.
| Compound Name | 3-(4,4-dimethylazepan-1-yl)-2-methylpropanimidamide |
|---|---|
| PubChem CID | 65281491 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 3-(4,4-dimethylazepan-1-yl)-2-methylpropanimidamide |
| SMILES | [H]/N=C(\N)C(C)CN1CCCC(C)(C)CC1 |
| InChI | InChI=1S/C12H25N3/c1-10(11(13)14)9-15-7-4-5-12(2,3)6-8-15/h10H,4-9H2,1-3H3,(H3,13,14) |
| InChIKey | ITLHZUVZVVGREI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|