C15H13N3O3S — CID 11449878
ethyl 4-oxo-7-phenyl-2-sulfanylidene-1H-pyrrolo[1,2-a][1,3,5]triazine-8-carboxylate (PubChem CID 11449878) has the molecular formula C15H13N3O3S and a molecular weight of 315.35 g/mol. Its IUPAC name is ethyl 4-oxo-7-phenyl-2-sulfanylidene-1H-pyrrolo[1,2-a][1,3,5]triazine-8-carboxylate.
| Compound Name | ethyl 4-oxo-7-phenyl-2-sulfanylidene-1H-pyrrolo[1,2-a][1,3,5]triazine-8-carboxylate |
|---|---|
| PubChem CID | 11449878 |
| Molecular Formula | C15H13N3O3S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | ethyl 4-oxo-7-phenyl-2-sulfanylidene-1H-pyrrolo[1,2-a][1,3,5]triazine-8-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)cn2c(=O)[nH]c(=S)[nH]c12 |
| InChI | InChI=1S/C15H13N3O3S/c1-2-21-13(19)11-10(9-6-4-3-5-7-9)8-18-12(11)16-14(22)17-15(18)20/h3-8H,2H2,1H3,(H2,16,17,20,22) |
| InChIKey | FVLYQPFMLLLQAH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 79.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|