C14H14F3NO2 — CID 114499783
3-methyl-1-[2-(trifluoromethyl)benzoyl]piperidin-4-one (PubChem CID 114499783) has the molecular formula C14H14F3NO2 and a molecular weight of 285.26 g/mol. Its IUPAC name is 3-methyl-1-[2-(trifluoromethyl)benzoyl]piperidin-4-one.
| Compound Name | 3-methyl-1-[2-(trifluoromethyl)benzoyl]piperidin-4-one |
|---|---|
| PubChem CID | 114499783 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3-methyl-1-[2-(trifluoromethyl)benzoyl]piperidin-4-one |
| SMILES | CC1CN(C(=O)c2ccccc2C(F)(F)F)CCC1=O |
| InChI | InChI=1S/C14H14F3NO2/c1-9-8-18(7-6-12(9)19)13(20)10-4-2-3-5-11(10)14(15,16)17/h2-5,9H,6-8H2,1H3 |
| InChIKey | KENUEXLDTKSYFR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |