C13H15ClN2O3 — CID 114500729
(3-chloro-4-hydroxyphenyl)-[(4E)-4-hydroxyimino-3-methylpiperidin-1-yl]methanone (PubChem CID 114500729) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is (3-chloro-4-hydroxyphenyl)-[(4E)-4-hydroxyimino-3-methylpiperidin-1-yl]methanone.
| Compound Name | (3-chloro-4-hydroxyphenyl)-[(4E)-4-hydroxyimino-3-methylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 114500729 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | (3-chloro-4-hydroxyphenyl)-[(4E)-4-hydroxyimino-3-methylpiperidin-1-yl]methanone |
| SMILES | CC1CN(C(=O)c2ccc(O)c(Cl)c2)CC/C1=N\O |
| InChI | InChI=1S/C13H15ClN2O3/c1-8-7-16(5-4-11(8)15-19)13(18)9-2-3-12(17)10(14)6-9/h2-3,6,8,17,19H,4-5,7H2,1H3/b15-11+ |
| InChIKey | FWBPLTQOPZJBKD-RVDMUPIBSA-N |
| XLogP | 2.36 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|