C11H13BrN2O2S — CID 107962412
(5-bromothiophen-3-yl)-(4-hydroxyimino-3-methylpiperidin-1-yl)methanone (PubChem CID 107962412) has the molecular formula C11H13BrN2O2S and a molecular weight of 317.21 g/mol. Its IUPAC name is (5-bromothiophen-3-yl)-(4-hydroxyimino-3-methylpiperidin-1-yl)methanone.
| Compound Name | (5-bromothiophen-3-yl)-(4-hydroxyimino-3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 107962412 |
| Molecular Formula | C11H13BrN2O2S |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | (5-bromothiophen-3-yl)-(4-hydroxyimino-3-methylpiperidin-1-yl)methanone |
| SMILES | CC1CN(C(=O)c2csc(Br)c2)CCC1=NO |
| InChI | InChI=1S/C11H13BrN2O2S/c1-7-5-14(3-2-9(7)13-16)11(15)8-4-10(12)17-6-8/h4,6-7,16H,2-3,5H2,1H3 |
| InChIKey | PAEZNNUJVQPMKG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|