About ethyl 3-amino-2-[(1,3-dimethylpiperidin-4-yl)amino]pyridine-4-carboxylate
ethyl 3-amino-2-[(1,3-dimethylpiperidin-4-yl)amino]pyridine-4-carboxylate (PubChem CID 114505844) has the molecular formula C15H24N4O2
and a molecular weight of 292.38 g/mol. Its IUPAC name is ethyl 3-amino-2-[(1,3-dimethylpiperidin-4-yl)amino]pyridine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-amino-2-[(1,3-dimethylpiperidin-4-yl)amino]pyridine-4-carboxylate |
| PubChem CID | 114505844 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | ethyl 3-amino-2-[(1,3-dimethylpiperidin-4-yl)amino]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(NC2CCN(C)CC2C)c1N |
| InChI | InChI=1S/C15H24N4O2/c1-4-21-15(20)11-5-7-17-14(13(11)16)18-12-6-8-19(3)9-10(12)2/h5,7,10,12H,4,6,8-9,16H2,1-3H3,(H,17,18) |
| InChIKey | ZGZYSULVIOAZPV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-amino-2-[(1,3-dimethylpiperidin-4-yl)amino]pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-amino-2-[(1,3-dimethylpiperidin-4-yl)amino]pyridine-4-carboxylate?
The IUPAC name of ethyl 3-amino-2-[(1,3-dimethylpiperidin-4-yl)amino]pyridine-4-carboxylate (CID 114505844) is ethyl 3-amino-2-[(1,3-dimethylpiperidin-4-yl)amino]pyridine-4-carboxylate.
What is the SMILES notation for ethyl 3-amino-2-[(1,3-dimethylpiperidin-4-yl)amino]pyridine-4-carboxylate?
The canonical SMILES for ethyl 3-amino-2-[(1,3-dimethylpiperidin-4-yl)amino]pyridine-4-carboxylate is CCOC(=O)c1ccnc(NC2CCN(C)CC2C)c1N.
What is the InChIKey of ethyl 3-amino-2-[(1,3-dimethylpiperidin-4-yl)amino]pyridine-4-carboxylate?
The InChIKey is ZGZYSULVIOAZPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4O2/c1-4-21-15(20)11-5-7-17-14(13(11)16)18-12-6-8-19(3)9-10(12)2/h5,7,10,12H,4,6,8-9,16H2,1-3H3,(H,17,18).
What are the key properties of ethyl 3-amino-2-[(1,3-dimethylpiperidin-4-yl)amino]pyridine-4-carboxylate?
ethyl 3-amino-2-[(1,3-dimethylpiperidin-4-yl)amino]pyridine-4-carboxylate has a molecular weight of 292.38 g/mol, XLogP of 1.59, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-amino-2-[(1,3-dimethylpiperidin-4-yl)amino]pyridine-4-carboxylate is sourced from PubChem (CID 114505844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).