C17H25FN2O — CID 114506842
[3-ethyl-4-(ethylamino)piperidin-1-yl]-(4-fluoro-2-methylphenyl)methanone (PubChem CID 114506842) has the molecular formula C17H25FN2O and a molecular weight of 292.40 g/mol. Its IUPAC name is [3-ethyl-4-(ethylamino)piperidin-1-yl]-(4-fluoro-2-methylphenyl)methanone.
| Compound Name | [3-ethyl-4-(ethylamino)piperidin-1-yl]-(4-fluoro-2-methylphenyl)methanone |
|---|---|
| PubChem CID | 114506842 |
| Molecular Formula | C17H25FN2O |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | [3-ethyl-4-(ethylamino)piperidin-1-yl]-(4-fluoro-2-methylphenyl)methanone |
| SMILES | CCNC1CCN(C(=O)c2ccc(F)cc2C)CC1CC |
| InChI | InChI=1S/C17H25FN2O/c1-4-13-11-20(9-8-16(13)19-5-2)17(21)15-7-6-14(18)10-12(15)3/h6-7,10,13,16,19H,4-5,8-9,11H2,1-3H3 |
| InChIKey | ROMBJHKLWMQSHP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |