C15H17BrF3NO — CID 11451354
4-[(Z)-3-bromo-1,1,1-trifluoro-5-phenylpent-2-en-2-yl]morpholine (PubChem CID 11451354) has the molecular formula C15H17BrF3NO and a molecular weight of 364.21 g/mol. Its IUPAC name is 4-[(Z)-3-bromo-1,1,1-trifluoro-5-phenylpent-2-en-2-yl]morpholine.
| Compound Name | 4-[(Z)-3-bromo-1,1,1-trifluoro-5-phenylpent-2-en-2-yl]morpholine |
|---|---|
| PubChem CID | 11451354 |
| Molecular Formula | C15H17BrF3NO |
| Molecular Weight | 364.21 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 4-[(Z)-3-bromo-1,1,1-trifluoro-5-phenylpent-2-en-2-yl]morpholine |
| SMILES | FC(F)(F)/C(=C(/Br)CCc1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C15H17BrF3NO/c16-13(7-6-12-4-2-1-3-5-12)14(15(17,18)19)20-8-10-21-11-9-20/h1-5H,6-11H2/b14-13- |
| InChIKey | NONCKBHQQUBNFW-YPKPFQOOSA-N |
| XLogP | 4.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.21 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |