C13H21N3O2S — CID 114516191
2-[1-[2-(1-methylpiperidin-4-yl)ethyl]imidazol-2-yl]sulfanylacetic acid (PubChem CID 114516191) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 2-[1-[2-(1-methylpiperidin-4-yl)ethyl]imidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[1-[2-(1-methylpiperidin-4-yl)ethyl]imidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 114516191 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-[1-[2-(1-methylpiperidin-4-yl)ethyl]imidazol-2-yl]sulfanylacetic acid |
| SMILES | CN1CCC(CCn2ccnc2SCC(=O)O)CC1 |
| InChI | InChI=1S/C13H21N3O2S/c1-15-6-2-11(3-7-15)4-8-16-9-5-14-13(16)19-10-12(17)18/h5,9,11H,2-4,6-8,10H2,1H3,(H,17,18) |
| InChIKey | RXAZSPQABVAAMN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |