C10H16N2O3S — CID 29063800
2-[1-(3-ethoxypropyl)imidazol-2-yl]sulfanylacetic acid (PubChem CID 29063800) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is 2-[1-(3-ethoxypropyl)imidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[1-(3-ethoxypropyl)imidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 29063800 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2-[1-(3-ethoxypropyl)imidazol-2-yl]sulfanylacetic acid |
| SMILES | CCOCCCn1ccnc1SCC(=O)O |
| InChI | InChI=1S/C10H16N2O3S/c1-2-15-7-3-5-12-6-4-11-10(12)16-8-9(13)14/h4,6H,2-3,5,7-8H2,1H3,(H,13,14) |
| InChIKey | FAFQTSWDGYWDGD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|