C17H17FN2O — CID 114523285
1-(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-(3-fluorophenyl)ethanone (PubChem CID 114523285) has the molecular formula C17H17FN2O and a molecular weight of 284.33 g/mol. Its IUPAC name is 1-(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-(3-fluorophenyl)ethanone.
| Compound Name | 1-(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-(3-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 114523285 |
| Molecular Formula | C17H17FN2O |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-(8-amino-3,4-dihydro-1H-isoquinolin-2-yl)-2-(3-fluorophenyl)ethanone |
| SMILES | Nc1cccc2c1CN(C(=O)Cc1cccc(F)c1)CC2 |
| InChI | InChI=1S/C17H17FN2O/c18-14-5-1-3-12(9-14)10-17(21)20-8-7-13-4-2-6-16(19)15(13)11-20/h1-6,9H,7-8,10-11,19H2 |
| InChIKey | GBJLJNWLKHQEDH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|